C11H15N5O4 — CID 136827823
propan-2-yl N-[4-[[(Z)-N'-nitrocarbamimidoyl]amino]phenyl]carbamate (PubChem CID 136827823) has the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. Its IUPAC name is propan-2-yl N-[4-[[(Z)-N'-nitrocarbamimidoyl]amino]phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-[[(Z)-N'-nitrocarbamimidoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 136827823 |
| Molecular Formula | C11H15N5O4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | propan-2-yl N-[4-[[(Z)-N'-nitrocarbamimidoyl]amino]phenyl]carbamate |
| SMILES | CC(C)OC(=O)Nc1ccc(N/C(N)=N\[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15N5O4/c1-7(2)20-11(17)14-9-5-3-8(4-6-9)13-10(12)15-16(18)19/h3-7H,1-2H3,(H,14,17)(H3,12,13,15) |
| InChIKey | SZQBKKAWXZMEOV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|