C18H15N3O — CID 136828463
(3Z)-3-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1H-indol-2-one (PubChem CID 136828463) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is (3Z)-3-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 136828463 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (3Z)-3-[(Z)-[(E)-2-methyl-3-phenylprop-2-enylidene]hydrazinylidene]-1H-indol-2-one |
| SMILES | CC(/C=N\N=C1/C(=O)Nc2ccccc21)=C\c1ccccc1 |
| InChI | InChI=1S/C18H15N3O/c1-13(11-14-7-3-2-4-8-14)12-19-21-17-15-9-5-6-10-16(15)20-18(17)22/h2-12H,1H3,(H,20,21,22)/b13-11+,19-12- |
| InChIKey | ZTPSJMXRTKMSCQ-KCVQHHRGSA-N |
| XLogP | 3.52 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|