C10H17IN4O — CID 136829857
4-[5-aminopentyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136829857) has the molecular formula C10H17IN4O and a molecular weight of 336.18 g/mol. Its IUPAC name is 4-[5-aminopentyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[5-aminopentyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136829857 |
| Molecular Formula | C10H17IN4O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[5-aminopentyl(methyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CN(CCCCCN)c1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H17IN4O/c1-15(6-4-2-3-5-12)9-8(11)10(16)14-7-13-9/h7H,2-6,12H2,1H3,(H,13,14,16) |
| InChIKey | QLGWZPOHFXIFPJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|