C21H20FN3O2 — CID 136831938
(3R)-3-(2-fluorophenyl)-N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-3-phenylpropanamide (PubChem CID 136831938) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is (3R)-3-(2-fluorophenyl)-N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-3-phenylpropanamide.
| Compound Name | (3R)-3-(2-fluorophenyl)-N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 136831938 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (3R)-3-(2-fluorophenyl)-N-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)methyl]-3-phenylpropanamide |
| SMILES | Cc1nc(CNC(=O)C[C@H](c2ccccc2)c2ccccc2F)cc(=O)[nH]1 |
| InChI | InChI=1S/C21H20FN3O2/c1-14-24-16(11-21(27)25-14)13-23-20(26)12-18(15-7-3-2-4-8-15)17-9-5-6-10-19(17)22/h2-11,18H,12-13H2,1H3,(H,23,26)(H,24,25,27)/t18-/m1/s1 |
| InChIKey | GRNCPZVOQLMVRN-GOSISDBHSA-N |
| XLogP | 3.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |