C28H22N4O2 — CID 136836269
N-[(Z)-(4-hydroxyphenyl)methylideneamino]-4-[(2-methylbenzo[h]quinolin-4-yl)amino]benzamide (PubChem CID 136836269) has the molecular formula C28H22N4O2 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxyphenyl)methylideneamino]-4-[(2-methylbenzo[h]quinolin-4-yl)amino]benzamide.
| Compound Name | N-[(Z)-(4-hydroxyphenyl)methylideneamino]-4-[(2-methylbenzo[h]quinolin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 136836269 |
| Molecular Formula | C28H22N4O2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[(Z)-(4-hydroxyphenyl)methylideneamino]-4-[(2-methylbenzo[h]quinolin-4-yl)amino]benzamide |
| SMILES | Cc1cc(Nc2ccc(C(=O)N/N=C\c3ccc(O)cc3)cc2)c2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C28H22N4O2/c1-18-16-26(25-15-10-20-4-2-3-5-24(20)27(25)30-18)31-22-11-8-21(9-12-22)28(34)32-29-17-19-6-13-23(33)14-7-19/h2-17,33H,1H3,(H,30,31)(H,32,34)/b29-17- |
| InChIKey | UDQUTGVOBJRTMT-RHANQZHGSA-N |
| XLogP | 5.91 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|