C8H9Cl3N4O2 — CID 136837181
2-[4-methyl-6-oxo-2-(trichloromethyl)-1H-pyrimidin-5-yl]acetohydrazide (PubChem CID 136837181) has the molecular formula C8H9Cl3N4O2 and a molecular weight of 299.55 g/mol. Its IUPAC name is 2-[4-methyl-6-oxo-2-(trichloromethyl)-1H-pyrimidin-5-yl]acetohydrazide.
| Compound Name | 2-[4-methyl-6-oxo-2-(trichloromethyl)-1H-pyrimidin-5-yl]acetohydrazide |
|---|---|
| PubChem CID | 136837181 |
| Molecular Formula | C8H9Cl3N4O2 |
| Molecular Weight | 299.55 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-[4-methyl-6-oxo-2-(trichloromethyl)-1H-pyrimidin-5-yl]acetohydrazide |
| SMILES | Cc1nc(C(Cl)(Cl)Cl)[nH]c(=O)c1CC(=O)NN |
| InChI | InChI=1S/C8H9Cl3N4O2/c1-3-4(2-5(16)15-12)6(17)14-7(13-3)8(9,10)11/h2,12H2,1H3,(H,15,16)(H,13,14,17) |
| InChIKey | SUWBHSZMLQQWKE-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.55 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|