C12H20N4O — CID 136839768
7-ethyl-6-methyl-2-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136839768) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 7-ethyl-6-methyl-2-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-ethyl-6-methyl-2-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136839768 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 7-ethyl-6-methyl-2-(oxolan-3-yl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCC1C(C)CNc2nc(C3CCOC3)nn21 |
| InChI | InChI=1S/C12H20N4O/c1-3-10-8(2)6-13-12-14-11(15-16(10)12)9-4-5-17-7-9/h8-10H,3-7H2,1-2H3,(H,13,14,15) |
| InChIKey | TTZICIBJXXHPBE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |