C13H16N4OS — CID 136839760
2-(oxolan-3-yl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 136839760) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-(oxolan-3-yl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 136839760 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(oxolan-3-yl)-7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1csc(C2CCNc3nc(C4CCOC4)nn32)c1 |
| InChI | InChI=1S/C13H16N4OS/c1-2-11(19-7-1)10-3-5-14-13-15-12(16-17(10)13)9-4-6-18-8-9/h1-2,7,9-10H,3-6,8H2,(H,14,15,16) |
| InChIKey | QAAOJXKGMPXHMI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |