C10H12N4OS — CID 136837739
(7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol (PubChem CID 136837739) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is (7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol.
| Compound Name | (7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol |
|---|---|
| PubChem CID | 136837739 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (7-thiophen-2-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanol |
| SMILES | OCc1nc2n(n1)C(c1cccs1)CCN2 |
| InChI | InChI=1S/C10H12N4OS/c15-6-9-12-10-11-4-3-7(14(10)13-9)8-2-1-5-16-8/h1-2,5,7,15H,3-4,6H2,(H,11,12,13) |
| InChIKey | MTKYRXSTLKCSCD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |