C10H15NOS — CID 102244531
[(2S,5R)-1-methyl-5-thiophen-2-ylpyrrolidin-2-yl]methanol (PubChem CID 102244531) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is [(2S,5R)-1-methyl-5-thiophen-2-ylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,5R)-1-methyl-5-thiophen-2-ylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102244531 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | [(2S,5R)-1-methyl-5-thiophen-2-ylpyrrolidin-2-yl]methanol |
| SMILES | CN1[C@H](CO)CC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C10H15NOS/c1-11-8(7-12)4-5-9(11)10-3-2-6-13-10/h2-3,6,8-9,12H,4-5,7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | UZSIAMIDUGPZPF-DTWKUNHWSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |