C9H12N2S — CID 163475702
2,5-dimethyl-3-thiophen-2-yl-3,4-dihydropyrazole (PubChem CID 163475702) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 2,5-dimethyl-3-thiophen-2-yl-3,4-dihydropyrazole.
| Compound Name | 2,5-dimethyl-3-thiophen-2-yl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 163475702 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2,5-dimethyl-3-thiophen-2-yl-3,4-dihydropyrazole |
| SMILES | CC1=NN(C)C(c2cccs2)C1 |
| InChI | InChI=1S/C9H12N2S/c1-7-6-8(11(2)10-7)9-4-3-5-12-9/h3-5,8H,6H2,1-2H3 |
| InChIKey | CAFBZVFZXQOUBW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |