C12H15N5 — CID 136840246
7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 136840246) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 136840246 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 7-(3-methylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Cc1cccc(C2CCNc3nc(N)nn32)c1 |
| InChI | InChI=1S/C12H15N5/c1-8-3-2-4-9(7-8)10-5-6-14-12-15-11(13)16-17(10)12/h2-4,7,10H,5-6H2,1H3,(H3,13,14,15,16) |
| InChIKey | ZOAJKEBPYDIXNS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |