C14H19N5 — CID 136840232
7-(4-propylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 136840232) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 7-(4-propylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-(4-propylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 136840232 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 7-(4-propylphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | CCCc1ccc(C2CCNc3nc(N)nn32)cc1 |
| InChI | InChI=1S/C14H19N5/c1-2-3-10-4-6-11(7-5-10)12-8-9-16-14-17-13(15)18-19(12)14/h4-7,12H,2-3,8-9H2,1H3,(H3,15,16,17,18) |
| InChIKey | KXUGQGAFXKQNBY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |