C17H18N4 — CID 136840416
2-methyl-5-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-4-yl)aniline (PubChem CID 136840416) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-methyl-5-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-4-yl)aniline.
| Compound Name | 2-methyl-5-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-4-yl)aniline |
|---|---|
| PubChem CID | 136840416 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-methyl-5-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-4-yl)aniline |
| SMILES | Cc1ccc(C2CCNc3nc4ccccc4n32)cc1N |
| InChI | InChI=1S/C17H18N4/c1-11-6-7-12(10-13(11)18)15-8-9-19-17-20-14-4-2-3-5-16(14)21(15)17/h2-7,10,15H,8-9,18H2,1H3,(H,19,20) |
| InChIKey | PDUJCDHLBOBRKN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|