About 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine
3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (PubChem CID 136841218) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
Analyze 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine?
The IUPAC name of 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine (CID 136841218) is 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine is CCc1cnn2c1NCCC2.
What is the InChIKey of 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine?
The InChIKey is USKRXLUEGRAGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-7-6-10-11-5-3-4-9-8(7)11/h6,9H,2-5H2,1H3.
What are the key properties of 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine?
3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine has a molecular weight of 151.21 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 136841218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).