C12H16BrF3N2O2 — CID 136842455
5-bromo-4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842455) has the molecular formula C12H16BrF3N2O2 and a molecular weight of 357.17 g/mol. Its IUPAC name is 5-bromo-4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842455 |
| Molecular Formula | C12H16BrF3N2O2 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 5-bromo-4-tert-butyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)c1nc(CCOCC(F)(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C12H16BrF3N2O2/c1-11(2,3)9-8(13)10(19)18-7(17-9)4-5-20-6-12(14,15)16/h4-6H2,1-3H3,(H,17,18,19) |
| InChIKey | PPMWFRPONTUZFK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|