C10H12BrF3N2O3 — CID 136842465
5-bromo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842465) has the molecular formula C10H12BrF3N2O3 and a molecular weight of 345.12 g/mol. Its IUPAC name is 5-bromo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842465 |
| Molecular Formula | C10H12BrF3N2O3 |
| Molecular Weight | 345.12 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 5-bromo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | COCc1nc(CCOCC(F)(F)F)[nH]c(=O)c1Br |
| InChI | InChI=1S/C10H12BrF3N2O3/c1-18-4-6-8(11)9(17)16-7(15-6)2-3-19-5-10(12,13)14/h2-5H2,1H3,(H,15,16,17) |
| InChIKey | UTIZQJDLXVSPKS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|