C10H12F3IN2O3 — CID 136842466
5-iodo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 136842466) has the molecular formula C10H12F3IN2O3 and a molecular weight of 392.12 g/mol. Its IUPAC name is 5-iodo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842466 |
| Molecular Formula | C10H12F3IN2O3 |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 5-iodo-4-(methoxymethyl)-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | COCc1nc(CCOCC(F)(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C10H12F3IN2O3/c1-18-4-6-8(14)9(17)16-7(15-6)2-3-19-5-10(11,12)13/h2-5H2,1H3,(H,15,16,17) |
| InChIKey | PDVPZSOOEWFSBR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|