C11H13F2IN2O2 — CID 136842469
4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136842469) has the molecular formula C11H13F2IN2O2 and a molecular weight of 370.14 g/mol. Its IUPAC name is 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842469 |
| Molecular Formula | C11H13F2IN2O2 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 4-cyclopropyl-2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)F)nc(C2CC2)c1I |
| InChI | InChI=1S/C11H13F2IN2O2/c12-7(13)5-18-4-3-8-15-10(6-1-2-6)9(14)11(17)16-8/h6-7H,1-5H2,(H,15,16,17) |
| InChIKey | MCHRRJOXKVJKGW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|