C9H11F2IN2O2 — CID 136842450
2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-methyl-1H-pyrimidin-6-one (PubChem CID 136842450) has the molecular formula C9H11F2IN2O2 and a molecular weight of 344.10 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136842450 |
| Molecular Formula | C9H11F2IN2O2 |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(CCOCC(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C9H11F2IN2O2/c1-5-8(12)9(15)14-7(13-5)2-3-16-4-6(10)11/h6H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | OQDODDQFGQXNHF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|