C8H8F3IN2O3 — CID 103146622
4-hydroxy-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103146622) has the molecular formula C8H8F3IN2O3 and a molecular weight of 364.06 g/mol. Its IUPAC name is 4-hydroxy-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146622 |
| Molecular Formula | C8H8F3IN2O3 |
| Molecular Weight | 364.06 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | 4-hydroxy-5-iodo-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)(F)F)nc(O)c1I |
| InChI | InChI=1S/C8H8F3IN2O3/c9-8(10,11)3-17-2-1-4-13-6(15)5(12)7(16)14-4/h1-3H2,(H2,13,14,15,16) |
| InChIKey | WQBOAJSCUIQTMW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.06 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|