C8H9F2IN2O3 — CID 103146621
2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one (PubChem CID 103146621) has the molecular formula C8H9F2IN2O3 and a molecular weight of 346.07 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146621 |
| Molecular Formula | C8H9F2IN2O3 |
| Molecular Weight | 346.07 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-iodo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)F)nc(O)c1I |
| InChI | InChI=1S/C8H9F2IN2O3/c9-4(10)3-16-2-1-5-12-7(14)6(11)8(15)13-5/h4H,1-3H2,(H2,12,13,14,15) |
| InChIKey | WZMLDAMWZDNROU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.07 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|