C8H8BrF3N2O3 — CID 103146620
5-bromo-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103146620) has the molecular formula C8H8BrF3N2O3 and a molecular weight of 317.06 g/mol. Its IUPAC name is 5-bromo-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146620 |
| Molecular Formula | C8H8BrF3N2O3 |
| Molecular Weight | 317.06 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 5-bromo-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)(F)F)nc(O)c1Br |
| InChI | InChI=1S/C8H8BrF3N2O3/c9-5-6(15)13-4(14-7(5)16)1-2-17-3-8(10,11)12/h1-3H2,(H2,13,14,15,16) |
| InChIKey | UCMFVLKHZPTASI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.06 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|