C8H9BrF2N2O2 — CID 103146644
5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103146644) has the molecular formula C8H9BrF2N2O2 and a molecular weight of 283.07 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146644 |
| Molecular Formula | C8H9BrF2N2O2 |
| Molecular Weight | 283.07 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(CCOCC(F)F)ncc1Br |
| InChI | InChI=1S/C8H9BrF2N2O2/c9-5-3-12-7(13-8(5)14)1-2-15-4-6(10)11/h3,6H,1-2,4H2,(H,12,13,14) |
| InChIKey | OJHIUCQKJROASG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.07 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|