C14H16N4O4S — CID 136844394
2-methyl-4-(4-pyridin-3-ylsulfonylmorpholin-2-yl)-1H-pyrimidin-6-one (PubChem CID 136844394) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-methyl-4-(4-pyridin-3-ylsulfonylmorpholin-2-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-(4-pyridin-3-ylsulfonylmorpholin-2-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136844394 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-methyl-4-(4-pyridin-3-ylsulfonylmorpholin-2-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C2CN(S(=O)(=O)c3cccnc3)CCO2)cc(=O)[nH]1 |
| InChI | InChI=1S/C14H16N4O4S/c1-10-16-12(7-14(19)17-10)13-9-18(5-6-22-13)23(20,21)11-3-2-4-15-8-11/h2-4,7-8,13H,5-6,9H2,1H3,(H,16,17,19) |
| InChIKey | WCEBQHVIAKQNAW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |