About 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one
4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one (PubChem CID 136847970) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one |
| PubChem CID | 136847970 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)C(CCO)Nc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C11H19N3O2/c1-11(2,3)8(4-5-15)14-9-6-10(16)13-7-12-9/h6-8,15H,4-5H2,1-3H3,(H2,12,13,14,16) |
| InChIKey | QELCDCLLXRSRMJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
The IUPAC name of 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one (CID 136847970) is 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one.
What is the SMILES notation for 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
The canonical SMILES for 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one is CC(C)(C)C(CCO)Nc1cc(=O)[nH]cn1.
What is the InChIKey of 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
The InChIKey is QELCDCLLXRSRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-11(2,3)8(4-5-15)14-9-6-10(16)13-7-12-9/h6-8,15H,4-5H2,1-3H3,(H2,12,13,14,16).
What are the key properties of 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one?
4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one has a molecular weight of 225.29 g/mol, XLogP of 0.98, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-hydroxy-4,4-dimethylpentan-3-yl)amino]-1H-pyrimidin-6-one is sourced from PubChem (CID 136847970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).