C7H11N5O3 — CID 136849661
3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-hydroxypropanamide (PubChem CID 136849661) has the molecular formula C7H11N5O3 and a molecular weight of 213.20 g/mol. Its IUPAC name is 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 136849661 |
| Molecular Formula | C7H11N5O3 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 3-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C7H11N5O3/c8-4-6(11-2-12-7(4)15)10-1-3(13)5(9)14/h2-3,13H,1,8H2,(H2,9,14)(H2,10,11,12,15) |
| InChIKey | QJYUKFJHIIJHEX-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |