C7H12N4O3 — CID 136976241
5-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one (PubChem CID 136976241) has the molecular formula C7H12N4O3 and a molecular weight of 200.20 g/mol. Its IUPAC name is 5-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976241 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-amino-4-(2,3-dihydroxypropylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCC(O)CO)nc[nH]c1=O |
| InChI | InChI=1S/C7H12N4O3/c8-5-6(9-1-4(13)2-12)10-3-11-7(5)14/h3-4,12-13H,1-2,8H2,(H2,9,10,11,14) |
| InChIKey | SXXUWGWYHVAXCV-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |