C11H18BrN3O — CID 136852207
5-bromo-4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one (PubChem CID 136852207) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 5-bromo-4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852207 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-bromo-4-(2,2,3-trimethylbutylamino)-1H-pyrimidin-6-one |
| SMILES | CC(C)C(C)(C)CNc1nc[nH]c(=O)c1Br |
| InChI | InChI=1S/C11H18BrN3O/c1-7(2)11(3,4)5-13-9-8(12)10(16)15-6-14-9/h6-7H,5H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | OJUFNRKTOREDMF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |