C10H14IN3O — CID 136852225
4-[(1-ethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136852225) has the molecular formula C10H14IN3O and a molecular weight of 319.15 g/mol. Its IUPAC name is 4-[(1-ethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(1-ethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852225 |
| Molecular Formula | C10H14IN3O |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-[(1-ethylcyclopropyl)methylamino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC1(CNc2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C10H14IN3O/c1-2-10(3-4-10)5-12-8-7(11)9(15)14-6-13-8/h6H,2-5H2,1H3,(H2,12,13,14,15) |
| InChIKey | DTBSGNKYXJQJPA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|