C11H16IN3O — CID 136852234
5-iodo-4-[(1-propylcyclopropyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136852234) has the molecular formula C11H16IN3O and a molecular weight of 333.17 g/mol. Its IUPAC name is 5-iodo-4-[(1-propylcyclopropyl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(1-propylcyclopropyl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136852234 |
| Molecular Formula | C11H16IN3O |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 5-iodo-4-[(1-propylcyclopropyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | CCCC1(CNc2nc[nH]c(=O)c2I)CC1 |
| InChI | InChI=1S/C11H16IN3O/c1-2-3-11(4-5-11)6-13-9-8(12)10(16)15-7-14-9/h7H,2-6H2,1H3,(H2,13,14,15,16) |
| InChIKey | PPBXHPUFFWDDTM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|