C26H26F3N5O4 — CID 136853087
[(5R,7S)-5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 136853087) has the molecular formula C26H26F3N5O4 and a molecular weight of 529.52 g/mol. Its IUPAC name is [(5R,7S)-5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(5R,7S)-5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 136853087 |
| Molecular Formula | C26H26F3N5O4 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | [(5R,7S)-5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2cc3n(n2)[C@H](C(F)(F)F)C[C@H](c2ccc4c(c2)OCO4)N3)CC1 |
| InChI | InChI=1S/C26H26F3N5O4/c1-36-20-5-3-2-4-19(20)32-8-10-33(11-9-32)25(35)18-14-24-30-17(13-23(26(27,28)29)34(24)31-18)16-6-7-21-22(12-16)38-15-37-21/h2-7,12,14,17,23,30H,8-11,13,15H2,1H3/t17-,23+/m1/s1 |
| InChIKey | LUCURHCKJAGUQX-HXOBKFHXSA-N |
| XLogP | 4.24 |
| TPSA | 81.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |