C16H15N3O2 — CID 136856984
(1R,2S,6R,7R,8S,10S)-4-[(E)-1H-pyrrol-2-ylmethylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 136856984) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is (1R,2S,6R,7R,8S,10S)-4-[(E)-1H-pyrrol-2-ylmethylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7R,8S,10S)-4-[(E)-1H-pyrrol-2-ylmethylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 136856984 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (1R,2S,6R,7R,8S,10S)-4-[(E)-1H-pyrrol-2-ylmethylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3C=C[C@H]([C@H]4C[C@H]34)[C@@H]2C(=O)N1/N=C/c1ccc[nH]1 |
| InChI | InChI=1S/C16H15N3O2/c20-15-13-9-3-4-10(12-6-11(9)12)14(13)16(21)19(15)18-7-8-2-1-5-17-8/h1-5,7,9-14,17H,6H2/b18-7+/t9-,10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | IDVPYOMTLIJLIY-CQRCYCNPSA-N |
| XLogP | 1.40 |
| TPSA | 65.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|