C17H20N4O2S — CID 136858367
2-amino-7-[(1S)-2,2-dimethyl-1-thiophen-2-ylcyclopropanecarbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 136858367) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-amino-7-[(1S)-2,2-dimethyl-1-thiophen-2-ylcyclopropanecarbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[(1S)-2,2-dimethyl-1-thiophen-2-ylcyclopropanecarbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136858367 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-amino-7-[(1S)-2,2-dimethyl-1-thiophen-2-ylcyclopropanecarbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC1(C)C[C@]1(C(=O)N1CCc2c(nc(N)[nH]c2=O)C1)c1cccs1 |
| InChI | InChI=1S/C17H20N4O2S/c1-16(2)9-17(16,12-4-3-7-24-12)14(23)21-6-5-10-11(8-21)19-15(18)20-13(10)22/h3-4,7H,5-6,8-9H2,1-2H3,(H3,18,19,20,22)/t17-/m1/s1 |
| InChIKey | LHLYQOQUGLLEPK-QGZVFWFLSA-N |
| XLogP | 1.67 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |