C17H20N6O3 — CID 137259019
2-amino-7-[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 137259019) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-amino-7-[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137259019 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-amino-7-[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(c(=O)[nH]1)CCN(C(=O)C1CC(c3ccccc3O)NN1)C2 |
| InChI | InChI=1S/C17H20N6O3/c18-17-19-13-8-23(6-5-10(13)15(25)20-17)16(26)12-7-11(21-22-12)9-3-1-2-4-14(9)24/h1-4,11-12,21-22,24H,5-8H2,(H3,18,19,20,25) |
| InChIKey | SXTQXMZZNHCEJV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|