C17H20N4O2 — CID 136860894
4-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]-2-[(4-methylphenyl)methylamino]-1H-pyrimidin-6-one (PubChem CID 136860894) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]-2-[(4-methylphenyl)methylamino]-1H-pyrimidin-6-one.
| Compound Name | 4-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]-2-[(4-methylphenyl)methylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136860894 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]-2-[(4-methylphenyl)methylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(CNc2nc([C@H]3CC(=O)N(C)C3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H20N4O2/c1-11-3-5-12(6-4-11)9-18-17-19-14(8-15(22)20-17)13-7-16(23)21(2)10-13/h3-6,8,13H,7,9-10H2,1-2H3,(H2,18,19,20,22)/t13-/m0/s1 |
| InChIKey | YFOQCXGFMYODQQ-ZDUSSCGKSA-N |
| XLogP | 1.64 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |