C25H24Cl2F3N5O — CID 1368613
(4-benzylpiperazin-1-yl)-[(5R,7R)-5-(3,4-dichlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 1368613) has the molecular formula C25H24Cl2F3N5O and a molecular weight of 538.40 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[(5R,7R)-5-(3,4-dichlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[(5R,7R)-5-(3,4-dichlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 1368613 |
| Molecular Formula | C25H24Cl2F3N5O |
| Molecular Weight | 538.40 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[(5R,7R)-5-(3,4-dichlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2n(n1)[C@@H](C(F)(F)F)C[C@H](c1ccc(Cl)c(Cl)c1)N2)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H24Cl2F3N5O/c26-18-7-6-17(12-19(18)27)20-13-22(25(28,29)30)35-23(31-20)14-21(32-35)24(36)34-10-8-33(9-11-34)15-16-4-2-1-3-5-16/h1-7,12,14,20,22,31H,8-11,13,15H2/t20-,22-/m1/s1 |
| InChIKey | IOCTUAMMOOOKNO-IFMALSPDSA-N |
| XLogP | 5.81 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |