C25H26ClF3N5O+ — CID 135820720
(4-benzylpiperazin-4-ium-1-yl)-[(5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 135820720) has the molecular formula C25H26ClF3N5O+ and a molecular weight of 504.96 g/mol. Its IUPAC name is (4-benzylpiperazin-4-ium-1-yl)-[(5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-4-ium-1-yl)-[(5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 135820720 |
| Molecular Formula | C25H26ClF3N5O+ |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (4-benzylpiperazin-4-ium-1-yl)-[(5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2n(n1)[C@H](C(F)(F)F)C[C@@H](c1ccc(Cl)cc1)N2)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H25ClF3N5O/c26-19-8-6-18(7-9-19)20-14-22(25(27,28)29)34-23(30-20)15-21(31-34)24(35)33-12-10-32(11-13-33)16-17-4-2-1-3-5-17/h1-9,15,20,22,30H,10-14,16H2/p+1/t20-,22-/m0/s1 |
| InChIKey | DREIFSDUOXOYET-UNMCSNQZSA-O |
| XLogP | 3.74 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |