C22H20ClF3N6OS — CID 136737204
1-benzyl-3-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiourea (PubChem CID 136737204) has the molecular formula C22H20ClF3N6OS and a molecular weight of 508.96 g/mol. Its IUPAC name is 1-benzyl-3-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 136737204 |
| Molecular Formula | C22H20ClF3N6OS |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-benzyl-3-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]thiourea |
| SMILES | O=C(NNC(=S)NCc1ccccc1)c1cc2n(n1)[C@H](C(F)(F)F)C[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C22H20ClF3N6OS/c23-15-8-6-14(7-9-15)16-10-18(22(24,25)26)32-19(28-16)11-17(31-32)20(33)29-30-21(34)27-12-13-4-2-1-3-5-13/h1-9,11,16,18,28H,10,12H2,(H,29,33)(H2,27,30,34)/t16-,18+/m1/s1 |
| InChIKey | XEAJGJUIONTLBA-AEFFLSMTSA-N |
| XLogP | 4.51 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|