C20H24ClF3N6O2S — CID 136737256
1-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea (PubChem CID 136737256) has the molecular formula C20H24ClF3N6O2S and a molecular weight of 504.97 g/mol. Its IUPAC name is 1-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 136737256 |
| Molecular Formula | C20H24ClF3N6O2S |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 1-[[(5R,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NNC(=O)c1cc2n(n1)[C@H](C(F)(F)F)C[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C20H24ClF3N6O2S/c1-2-32-9-3-8-25-19(33)28-27-18(31)15-11-17-26-14(12-4-6-13(21)7-5-12)10-16(20(22,23)24)30(17)29-15/h4-7,11,14,16,26H,2-3,8-10H2,1H3,(H,27,31)(H2,25,28,33)/t14-,16+/m1/s1 |
| InChIKey | DXDSDUIHAWVREV-ZBFHGGJFSA-N |
| XLogP | 3.73 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|