C22H29F3N6O2S — CID 135568045
1-[[5-(3,4-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea (PubChem CID 135568045) has the molecular formula C22H29F3N6O2S and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-[[5-(3,4-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[[5-(3,4-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 135568045 |
| Molecular Formula | C22H29F3N6O2S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[[5-(3,4-dimethylphenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)NNC(=O)c1cc2n(n1)C(C(F)(F)F)CC(c1ccc(C)c(C)c1)N2 |
| InChI | InChI=1S/C22H29F3N6O2S/c1-4-33-9-5-8-26-21(34)29-28-20(32)17-12-19-27-16(15-7-6-13(2)14(3)10-15)11-18(22(23,24)25)31(19)30-17/h6-7,10,12,16,18,27H,4-5,8-9,11H2,1-3H3,(H,28,32)(H2,26,29,34) |
| InChIKey | SMMLMUQSGJILLV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|