C20H18ClF3N6O2S — CID 135568020
1-[[5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(furan-2-ylmethyl)thiourea (PubChem CID 135568020) has the molecular formula C20H18ClF3N6O2S and a molecular weight of 498.92 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[[5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 135568020 |
| Molecular Formula | C20H18ClF3N6O2S |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-[[5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-(furan-2-ylmethyl)thiourea |
| SMILES | O=C(NNC(=S)NCc1ccco1)c1cc2n(n1)C(C(F)(F)F)CC(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C20H18ClF3N6O2S/c21-12-5-3-11(4-6-12)14-8-16(20(22,23)24)30-17(26-14)9-15(29-30)18(31)27-28-19(33)25-10-13-2-1-7-32-13/h1-7,9,14,16,26H,8,10H2,(H,27,31)(H2,25,28,33) |
| InChIKey | CYJIVYMUOQWIED-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|