C22H28ClF3N4O — CID 136853455
(5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 136853455) has the molecular formula C22H28ClF3N4O and a molecular weight of 456.94 g/mol. Its IUPAC name is (5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 136853455 |
| Molecular Formula | C22H28ClF3N4O |
| Molecular Weight | 456.94 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (5S,7S)-5-(4-chlorophenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)c1cc2n(n1)[C@H](C(F)(F)F)C[C@@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C22H28ClF3N4O/c1-20(2,3)12-21(4,5)28-19(31)16-11-18-27-15(13-6-8-14(23)9-7-13)10-17(22(24,25)26)30(18)29-16/h6-9,11,15,17,27H,10,12H2,1-5H3,(H,28,31)/t15-,17-/m0/s1 |
| InChIKey | CXIDQRSYDVIXSX-RDJZCZTQSA-N |
| XLogP | 6.14 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.94 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |