C23H31F3N4O — CID 3608015
5-(4-methylphenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 3608015) has the molecular formula C23H31F3N4O and a molecular weight of 436.52 g/mol. Its IUPAC name is 5-(4-methylphenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(4-methylphenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 3608015 |
| Molecular Formula | C23H31F3N4O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 5-(4-methylphenyl)-7-(trifluoromethyl)-N-(2,4,4-trimethylpentan-2-yl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1ccc(C2CC(C(F)(F)F)n3nc(C(=O)NC(C)(C)CC(C)(C)C)cc3N2)cc1 |
| InChI | InChI=1S/C23H31F3N4O/c1-14-7-9-15(10-8-14)16-11-18(23(24,25)26)30-19(27-16)12-17(29-30)20(31)28-22(5,6)13-21(2,3)4/h7-10,12,16,18,27H,11,13H2,1-6H3,(H,28,31) |
| InChIKey | ILFZSDGQNVHWQB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |