C22H24N2O6 — CID 136862306
cis-(3R,4S)-3,4-bis[(2-hydroxy-3-methoxyphenyl)methylideneamino]cyclopentane-1-carboxylic acid (PubChem CID 136862306) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is cis-(3R,4S)-3,4-bis[(2-hydroxy-3-methoxyphenyl)methylideneamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(3R,4S)-3,4-bis[(2-hydroxy-3-methoxyphenyl)methylideneamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 136862306 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | cis-(3R,4S)-3,4-bis[(2-hydroxy-3-methoxyphenyl)methylideneamino]cyclopentane-1-carboxylic acid |
| SMILES | COc1cccc(/C=N/[C@H]2CC(C(=O)O)C[C@H]2/N=C/c2cccc(OC)c2O)c1O |
| InChI | InChI=1S/C22H24N2O6/c1-29-18-7-3-5-13(20(18)25)11-23-16-9-15(22(27)28)10-17(16)24-12-14-6-4-8-19(30-2)21(14)26/h3-8,11-12,15-17,25-26H,9-10H2,1-2H3,(H,27,28)/b23-11+,24-12+/t15?,16-,17+ |
| InChIKey | RYBOSPAJCDAHGF-WKVWIYOKSA-N |
| XLogP | 2.88 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|