C10H16IN3O3 — CID 136864253
4-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136864253) has the molecular formula C10H16IN3O3 and a molecular weight of 353.16 g/mol. Its IUPAC name is 4-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136864253 |
| Molecular Formula | C10H16IN3O3 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 4-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | COCCC(C)(O)CNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C10H16IN3O3/c1-10(16,3-4-17-2)5-12-8-7(11)9(15)14-6-13-8/h6,16H,3-5H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | CEFLSPQQINEXOH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|