C11H18IN3O2 — CID 136723594
5-iodo-4-[(4-methoxy-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one (PubChem CID 136723594) has the molecular formula C11H18IN3O2 and a molecular weight of 351.19 g/mol. Its IUPAC name is 5-iodo-4-[(4-methoxy-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-[(4-methoxy-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136723594 |
| Molecular Formula | C11H18IN3O2 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 5-iodo-4-[(4-methoxy-2,2-dimethylbutyl)amino]-1H-pyrimidin-6-one |
| SMILES | COCCC(C)(C)CNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H18IN3O2/c1-11(2,4-5-17-3)6-13-9-8(12)10(16)15-7-14-9/h7H,4-6H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | JZQAQHBHDNTBKF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|