C11H19IN4O — CID 136864216
4-[[2-(aminomethyl)-2-ethylbutyl]amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136864216) has the molecular formula C11H19IN4O and a molecular weight of 350.20 g/mol. Its IUPAC name is 4-[[2-(aminomethyl)-2-ethylbutyl]amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[[2-(aminomethyl)-2-ethylbutyl]amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136864216 |
| Molecular Formula | C11H19IN4O |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 4-[[2-(aminomethyl)-2-ethylbutyl]amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCC(CC)(CN)CNc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C11H19IN4O/c1-3-11(4-2,5-13)6-14-9-8(12)10(17)16-7-15-9/h7H,3-6,13H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | CRBVQNBNMPQABQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|