About dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate
dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate (PubChem CID 136866772) has the molecular formula C4H8N2O2S2
and a molecular weight of 180.25 g/mol. Its IUPAC name is dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate.
Molecular Properties
| Compound Name | dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate |
| PubChem CID | 136866772 |
| Molecular Formula | C4H8N2O2S2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate |
| SMILES | CSC(=N\O)/C(=N\O)SC |
| InChI | InChI=1S/C4H8N2O2S2/c1-9-3(5-7)4(6-8)10-2/h7-8H,1-2H3/b5-3-,6-4+ |
| InChIKey | RIVVKXGSPZGDFF-CIIODKQPSA-N |
| XLogP | 1.29 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate?
The IUPAC name of dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate (CID 136866772) is dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate.
What is the SMILES notation for dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate?
The canonical SMILES for dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate is CSC(=N\O)/C(=N\O)SC.
What is the InChIKey of dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate?
The InChIKey is RIVVKXGSPZGDFF-CIIODKQPSA-N. The full InChI is InChI=1S/C4H8N2O2S2/c1-9-3(5-7)4(6-8)10-2/h7-8H,1-2H3/b5-3-,6-4+.
What are the key properties of dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate?
dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate has a molecular weight of 180.25 g/mol, XLogP of 1.29, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1E,2Z)-N,N'-dihydroxyethanediimidothioate is sourced from PubChem (CID 136866772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).