About methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine
methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine (PubChem CID 172919861) has the molecular formula C7H13I2N3O3S
and a molecular weight of 473.07 g/mol. Its IUPAC name is methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine.
Molecular Properties
| Compound Name | methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine |
| PubChem CID | 172919861 |
| Molecular Formula | C7H13I2N3O3S |
| Molecular Weight | 473.07 g/mol |
| Exact Mass | 472.88 |
| IUPAC Name | methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine |
| SMILES | CN=C=O.CS/C(=N/O)C(=O)N(C)C.II |
| InChI | InChI=1S/C5H10N2O2S.C2H3NO.I2/c1-7(2)5(8)4(6-9)10-3;1-3-2-4;1-2/h9H,1-3H3;1H3;/b6-4+;; |
| InChIKey | YYJAQGQSEDYIBI-SLNOCBGISA-N |
| XLogP | 1.95 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.07 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine?
The IUPAC name of methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine (CID 172919861) is methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine.
What is the SMILES notation for methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine?
The canonical SMILES for methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine is CN=C=O.CS/C(=N/O)C(=O)N(C)C.II.
What is the InChIKey of methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine?
The InChIKey is YYJAQGQSEDYIBI-SLNOCBGISA-N. The full InChI is InChI=1S/C5H10N2O2S.C2H3NO.I2/c1-7(2)5(8)4(6-9)10-3;1-3-2-4;1-2/h9H,1-3H3;1H3;/b6-4+;;.
What are the key properties of methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine?
methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine has a molecular weight of 473.07 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1E)-2-(dimethylamino)-N-hydroxy-2-oxoethanimidothioate;methylimino(oxo)methane;molecular iodine is sourced from PubChem (CID 172919861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).